About (2Z)-2-[7-(dimethylamino)-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene]-1-phenylethanone
(2Z)-2-[7-(dimethylamino)-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene]-1-phenylethanone (PubChem CID 22290775) has the molecular formula C21H24N2O
and a molecular weight of 320.44 g/mol. Its IUPAC name is (2Z)-2-[7-(dimethylamino)-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene]-1-phenylethanone.
Molecular Properties
| Compound Name | (2Z)-2-[7-(dimethylamino)-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene]-1-phenylethanone |
| PubChem CID | 22290775 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | (2Z)-2-[7-(dimethylamino)-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene]-1-phenylethanone |
| SMILES | CN(C)c1ccc2c(c1)/C(=C/C(=O)c1ccccc1)NC(C)(C)C2 |
| InChI | InChI=1S/C21H24N2O/c1-21(2)14-16-10-11-17(23(3)4)12-18(16)19(22-21)13-20(24)15-8-6-5-7-9-15/h5-13,22H,14H2,1-4H3/b19-13- |
| InChIKey | SEXCPULQFGZVHP-UYRXBGFRSA-N |
| XLogP | 3.90 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-[7-(dimethylamino)-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene]-1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-[7-(dimethylamino)-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene]-1-phenylethanone?
The IUPAC name of (2Z)-2-[7-(dimethylamino)-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene]-1-phenylethanone (CID 22290775) is (2Z)-2-[7-(dimethylamino)-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene]-1-phenylethanone.
What is the SMILES notation for (2Z)-2-[7-(dimethylamino)-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene]-1-phenylethanone?
The canonical SMILES for (2Z)-2-[7-(dimethylamino)-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene]-1-phenylethanone is CN(C)c1ccc2c(c1)/C(=C/C(=O)c1ccccc1)NC(C)(C)C2.
What is the InChIKey of (2Z)-2-[7-(dimethylamino)-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene]-1-phenylethanone?
The InChIKey is SEXCPULQFGZVHP-UYRXBGFRSA-N. The full InChI is InChI=1S/C21H24N2O/c1-21(2)14-16-10-11-17(23(3)4)12-18(16)19(22-21)13-20(24)15-8-6-5-7-9-15/h5-13,22H,14H2,1-4H3/b19-13-.
What are the key properties of (2Z)-2-[7-(dimethylamino)-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene]-1-phenylethanone?
(2Z)-2-[7-(dimethylamino)-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene]-1-phenylethanone has a molecular weight of 320.44 g/mol, XLogP of 3.90, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-[7-(dimethylamino)-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene]-1-phenylethanone is sourced from PubChem (CID 22290775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).