About 2-[[2-(3,4-dichloroanilino)quinazolin-4-yl]amino]ethanol
2-[[2-(3,4-dichloroanilino)quinazolin-4-yl]amino]ethanol (PubChem CID 2229100) has the molecular formula C16H14Cl2N4O
and a molecular weight of 349.22 g/mol. Its IUPAC name is 2-[[2-(3,4-dichloroanilino)quinazolin-4-yl]amino]ethanol.
Molecular Properties
| Compound Name | 2-[[2-(3,4-dichloroanilino)quinazolin-4-yl]amino]ethanol |
| PubChem CID | 2229100 |
| Molecular Formula | C16H14Cl2N4O |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 2-[[2-(3,4-dichloroanilino)quinazolin-4-yl]amino]ethanol |
| SMILES | OCCNc1nc(Nc2ccc(Cl)c(Cl)c2)nc2ccccc12 |
| InChI | InChI=1S/C16H14Cl2N4O/c17-12-6-5-10(9-13(12)18)20-16-21-14-4-2-1-3-11(14)15(22-16)19-7-8-23/h1-6,9,23H,7-8H2,(H2,19,20,21,22) |
| InChIKey | ZGMMVVYGDFQTBB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[2-(3,4-dichloroanilino)quinazolin-4-yl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(3,4-dichloroanilino)quinazolin-4-yl]amino]ethanol?
The IUPAC name of 2-[[2-(3,4-dichloroanilino)quinazolin-4-yl]amino]ethanol (CID 2229100) is 2-[[2-(3,4-dichloroanilino)quinazolin-4-yl]amino]ethanol.
What is the SMILES notation for 2-[[2-(3,4-dichloroanilino)quinazolin-4-yl]amino]ethanol?
The canonical SMILES for 2-[[2-(3,4-dichloroanilino)quinazolin-4-yl]amino]ethanol is OCCNc1nc(Nc2ccc(Cl)c(Cl)c2)nc2ccccc12.
What is the InChIKey of 2-[[2-(3,4-dichloroanilino)quinazolin-4-yl]amino]ethanol?
The InChIKey is ZGMMVVYGDFQTBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14Cl2N4O/c17-12-6-5-10(9-13(12)18)20-16-21-14-4-2-1-3-11(14)15(22-16)19-7-8-23/h1-6,9,23H,7-8H2,(H2,19,20,21,22).
What are the key properties of 2-[[2-(3,4-dichloroanilino)quinazolin-4-yl]amino]ethanol?
2-[[2-(3,4-dichloroanilino)quinazolin-4-yl]amino]ethanol has a molecular weight of 349.22 g/mol, XLogP of 4.08, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(3,4-dichloroanilino)quinazolin-4-yl]amino]ethanol is sourced from PubChem (CID 2229100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).