C32H31N3O4 — CID 22291046
N-[4-methyl-3-[(4-phenylmethoxybenzoyl)amino]phenyl]-3-morpholin-4-ylbenzamide (PubChem CID 22291046) has the molecular formula C32H31N3O4 and a molecular weight of 521.62 g/mol. Its IUPAC name is N-[4-methyl-3-[(4-phenylmethoxybenzoyl)amino]phenyl]-3-morpholin-4-ylbenzamide.
| Compound Name | N-[4-methyl-3-[(4-phenylmethoxybenzoyl)amino]phenyl]-3-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 22291046 |
| Molecular Formula | C32H31N3O4 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | N-[4-methyl-3-[(4-phenylmethoxybenzoyl)amino]phenyl]-3-morpholin-4-ylbenzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(N3CCOCC3)c2)cc1NC(=O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C32H31N3O4/c1-23-10-13-27(33-32(37)26-8-5-9-28(20-26)35-16-18-38-19-17-35)21-30(23)34-31(36)25-11-14-29(15-12-25)39-22-24-6-3-2-4-7-24/h2-15,20-21H,16-19,22H2,1H3,(H,33,37)(H,34,36) |
| InChIKey | VCCDQSPTHMYMNR-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |