About spiro[1-azabicyclo[2.2.1]heptane-7,3'-pyrrolidine]
spiro[1-azabicyclo[2.2.1]heptane-7,3'-pyrrolidine] (PubChem CID 22291204) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is spiro[1-azabicyclo[2.2.1]heptane-7,3'-pyrrolidine].
Molecular Properties
| Compound Name | spiro[1-azabicyclo[2.2.1]heptane-7,3'-pyrrolidine] |
| PubChem CID | 22291204 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | spiro[1-azabicyclo[2.2.1]heptane-7,3'-pyrrolidine] |
| SMILES | C1CC2(CN1)C1CCN2CC1 |
| InChI | InChI=1S/C9H16N2/c1-5-11-6-2-8(1)9(11)3-4-10-7-9/h8,10H,1-7H2 |
| InChIKey | KRMSXHMBJVUIRD-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[1-azabicyclo[2.2.1]heptane-7,3'-pyrrolidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1-azabicyclo[2.2.1]heptane-7,3'-pyrrolidine]?
The IUPAC name of spiro[1-azabicyclo[2.2.1]heptane-7,3'-pyrrolidine] (CID 22291204) is spiro[1-azabicyclo[2.2.1]heptane-7,3'-pyrrolidine].
What is the SMILES notation for spiro[1-azabicyclo[2.2.1]heptane-7,3'-pyrrolidine]?
The canonical SMILES for spiro[1-azabicyclo[2.2.1]heptane-7,3'-pyrrolidine] is C1CC2(CN1)C1CCN2CC1.
What is the InChIKey of spiro[1-azabicyclo[2.2.1]heptane-7,3'-pyrrolidine]?
The InChIKey is KRMSXHMBJVUIRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-5-11-6-2-8(1)9(11)3-4-10-7-9/h8,10H,1-7H2.
What are the key properties of spiro[1-azabicyclo[2.2.1]heptane-7,3'-pyrrolidine]?
spiro[1-azabicyclo[2.2.1]heptane-7,3'-pyrrolidine] has a molecular weight of 152.24 g/mol, XLogP of 0.44, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1-azabicyclo[2.2.1]heptane-7,3'-pyrrolidine] is sourced from PubChem (CID 22291204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).