About 7-pyridin-3-yl-1,7-diazaspiro[4.4]nonane;dihydrochloride
7-pyridin-3-yl-1,7-diazaspiro[4.4]nonane;dihydrochloride (PubChem CID 22291216) has the molecular formula C12H19Cl2N3
and a molecular weight of 276.21 g/mol. Its IUPAC name is 7-pyridin-3-yl-1,7-diazaspiro[4.4]nonane;dihydrochloride.
Molecular Properties
| Compound Name | 7-pyridin-3-yl-1,7-diazaspiro[4.4]nonane;dihydrochloride |
| PubChem CID | 22291216 |
| Molecular Formula | C12H19Cl2N3 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 7-pyridin-3-yl-1,7-diazaspiro[4.4]nonane;dihydrochloride |
| SMILES | Cl.Cl.c1cncc(N2CCC3(CCCN3)C2)c1 |
| InChI | InChI=1S/C12H17N3.2ClH/c1-3-11(9-13-6-1)15-8-5-12(10-15)4-2-7-14-12;;/h1,3,6,9,14H,2,4-5,7-8,10H2;2*1H |
| InChIKey | UFRFTXJBECHQSJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-pyridin-3-yl-1,7-diazaspiro[4.4]nonane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-pyridin-3-yl-1,7-diazaspiro[4.4]nonane;dihydrochloride?
The IUPAC name of 7-pyridin-3-yl-1,7-diazaspiro[4.4]nonane;dihydrochloride (CID 22291216) is 7-pyridin-3-yl-1,7-diazaspiro[4.4]nonane;dihydrochloride.
What is the SMILES notation for 7-pyridin-3-yl-1,7-diazaspiro[4.4]nonane;dihydrochloride?
The canonical SMILES for 7-pyridin-3-yl-1,7-diazaspiro[4.4]nonane;dihydrochloride is Cl.Cl.c1cncc(N2CCC3(CCCN3)C2)c1.
What is the InChIKey of 7-pyridin-3-yl-1,7-diazaspiro[4.4]nonane;dihydrochloride?
The InChIKey is UFRFTXJBECHQSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3.2ClH/c1-3-11(9-13-6-1)15-8-5-12(10-15)4-2-7-14-12;;/h1,3,6,9,14H,2,4-5,7-8,10H2;2*1H.
What are the key properties of 7-pyridin-3-yl-1,7-diazaspiro[4.4]nonane;dihydrochloride?
7-pyridin-3-yl-1,7-diazaspiro[4.4]nonane;dihydrochloride has a molecular weight of 276.21 g/mol, XLogP of 2.26, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-pyridin-3-yl-1,7-diazaspiro[4.4]nonane;dihydrochloride is sourced from PubChem (CID 22291216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).