About 2-(6-chloro-3-pyridinyl)-2,7-diazaspiro[4.4]nonane
2-(6-chloro-3-pyridinyl)-2,7-diazaspiro[4.4]nonane (PubChem CID 22291236) has the molecular formula C12H16ClN3
and a molecular weight of 237.73 g/mol. Its IUPAC name is 2-(6-chloro-3-pyridinyl)-2,7-diazaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 2-(6-chloro-3-pyridinyl)-2,7-diazaspiro[4.4]nonane |
| PubChem CID | 22291236 |
| Molecular Formula | C12H16ClN3 |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2-(6-chloro-3-pyridinyl)-2,7-diazaspiro[4.4]nonane |
| SMILES | Clc1ccc(N2CCC3(CCNC3)C2)cn1 |
| InChI | InChI=1S/C12H16ClN3/c13-11-2-1-10(7-15-11)16-6-4-12(9-16)3-5-14-8-12/h1-2,7,14H,3-6,8-9H2 |
| InChIKey | RVRWHEINTYMPOQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-chloro-3-pyridinyl)-2,7-diazaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-chloro-3-pyridinyl)-2,7-diazaspiro[4.4]nonane?
The IUPAC name of 2-(6-chloro-3-pyridinyl)-2,7-diazaspiro[4.4]nonane (CID 22291236) is 2-(6-chloro-3-pyridinyl)-2,7-diazaspiro[4.4]nonane.
What is the SMILES notation for 2-(6-chloro-3-pyridinyl)-2,7-diazaspiro[4.4]nonane?
The canonical SMILES for 2-(6-chloro-3-pyridinyl)-2,7-diazaspiro[4.4]nonane is Clc1ccc(N2CCC3(CCNC3)C2)cn1.
What is the InChIKey of 2-(6-chloro-3-pyridinyl)-2,7-diazaspiro[4.4]nonane?
The InChIKey is RVRWHEINTYMPOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16ClN3/c13-11-2-1-10(7-15-11)16-6-4-12(9-16)3-5-14-8-12/h1-2,7,14H,3-6,8-9H2.
What are the key properties of 2-(6-chloro-3-pyridinyl)-2,7-diazaspiro[4.4]nonane?
2-(6-chloro-3-pyridinyl)-2,7-diazaspiro[4.4]nonane has a molecular weight of 237.73 g/mol, XLogP of 1.92, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-chloro-3-pyridinyl)-2,7-diazaspiro[4.4]nonane is sourced from PubChem (CID 22291236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).