About 1-(1,3-thiazol-2-yl)butan-1-one
1-(1,3-thiazol-2-yl)butan-1-one (PubChem CID 22291405) has the molecular formula C7H9NOS
and a molecular weight of 155.22 g/mol. Its IUPAC name is 1-(1,3-thiazol-2-yl)butan-1-one.
Molecular Properties
| Compound Name | 1-(1,3-thiazol-2-yl)butan-1-one |
| PubChem CID | 22291405 |
| Molecular Formula | C7H9NOS |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.04 |
| IUPAC Name | 1-(1,3-thiazol-2-yl)butan-1-one |
| SMILES | CCCC(=O)c1nccs1 |
| InChI | InChI=1S/C7H9NOS/c1-2-3-6(9)7-8-4-5-10-7/h4-5H,2-3H2,1H3 |
| InChIKey | PKZQHUSSGTVETH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1,3-thiazol-2-yl)butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-thiazol-2-yl)butan-1-one?
The IUPAC name of 1-(1,3-thiazol-2-yl)butan-1-one (CID 22291405) is 1-(1,3-thiazol-2-yl)butan-1-one.
What is the SMILES notation for 1-(1,3-thiazol-2-yl)butan-1-one?
The canonical SMILES for 1-(1,3-thiazol-2-yl)butan-1-one is CCCC(=O)c1nccs1.
What is the InChIKey of 1-(1,3-thiazol-2-yl)butan-1-one?
The InChIKey is PKZQHUSSGTVETH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NOS/c1-2-3-6(9)7-8-4-5-10-7/h4-5H,2-3H2,1H3.
What are the key properties of 1-(1,3-thiazol-2-yl)butan-1-one?
1-(1,3-thiazol-2-yl)butan-1-one has a molecular weight of 155.22 g/mol, XLogP of 2.13, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-thiazol-2-yl)butan-1-one is sourced from PubChem (CID 22291405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).