C26H20ClN5O4 — CID 22291443
8-[(5-amino-2-chlorobenzoyl)amino]-1-(1,3-benzodioxol-5-yl)-4,5-dihydrobenzo[g]indazole-3-carboxamide (PubChem CID 22291443) has the molecular formula C26H20ClN5O4 and a molecular weight of 501.93 g/mol. Its IUPAC name is 8-[(5-amino-2-chlorobenzoyl)amino]-1-(1,3-benzodioxol-5-yl)-4,5-dihydrobenzo[g]indazole-3-carboxamide.
| Compound Name | 8-[(5-amino-2-chlorobenzoyl)amino]-1-(1,3-benzodioxol-5-yl)-4,5-dihydrobenzo[g]indazole-3-carboxamide |
|---|---|
| PubChem CID | 22291443 |
| Molecular Formula | C26H20ClN5O4 |
| Molecular Weight | 501.93 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | 8-[(5-amino-2-chlorobenzoyl)amino]-1-(1,3-benzodioxol-5-yl)-4,5-dihydrobenzo[g]indazole-3-carboxamide |
| SMILES | NC(=O)c1nn(-c2ccc3c(c2)OCO3)c2c1CCc1ccc(NC(=O)c3cc(N)ccc3Cl)cc1-2 |
| InChI | InChI=1S/C26H20ClN5O4/c27-20-7-3-14(28)9-19(20)26(34)30-15-4-1-13-2-6-17-23(25(29)33)31-32(24(17)18(13)10-15)16-5-8-21-22(11-16)36-12-35-21/h1,3-5,7-11H,2,6,12,28H2,(H2,29,33)(H,30,34) |
| InChIKey | AAZLFUOWXQSORW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 134.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.93 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|