C30H26ClN5O3 — CID 22291843
8-[(2-chlorobenzoyl)amino]-1-[4-[(E)-3-(ethylamino)-3-oxoprop-1-enyl]phenyl]-4,5-dihydrobenzo[g]indazole-3-carboxamide (PubChem CID 22291843) has the molecular formula C30H26ClN5O3 and a molecular weight of 540.02 g/mol. Its IUPAC name is 8-[(2-chlorobenzoyl)amino]-1-[4-[(E)-3-(ethylamino)-3-oxoprop-1-enyl]phenyl]-4,5-dihydrobenzo[g]indazole-3-carboxamide.
| Compound Name | 8-[(2-chlorobenzoyl)amino]-1-[4-[(E)-3-(ethylamino)-3-oxoprop-1-enyl]phenyl]-4,5-dihydrobenzo[g]indazole-3-carboxamide |
|---|---|
| PubChem CID | 22291843 |
| Molecular Formula | C30H26ClN5O3 |
| Molecular Weight | 540.02 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | 8-[(2-chlorobenzoyl)amino]-1-[4-[(E)-3-(ethylamino)-3-oxoprop-1-enyl]phenyl]-4,5-dihydrobenzo[g]indazole-3-carboxamide |
| SMILES | CCNC(=O)/C=C/c1ccc(-n2nc(C(N)=O)c3c2-c2cc(NC(=O)c4ccccc4Cl)ccc2CC3)cc1 |
| InChI | InChI=1S/C30H26ClN5O3/c1-2-33-26(37)16-9-18-7-13-21(14-8-18)36-28-23(27(35-36)29(32)38)15-11-19-10-12-20(17-24(19)28)34-30(39)22-5-3-4-6-25(22)31/h3-10,12-14,16-17H,2,11,15H2,1H3,(H2,32,38)(H,33,37)(H,34,39)/b16-9+ |
| InChIKey | ONWNRLFGSFILOK-CXUHLZMHSA-N |
| XLogP | 4.79 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.02 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|