1-hydroxycyclohexa-3,5-diene-1,2-dicarboxylic acid

C8H8O5 — CID 22292283

IUPAC1-hydroxycyclohexa-3,5-diene-1,2-dicarboxylic acid
SMILESO=C(O)C1C=CC=CC1(O)C(=O)O
InChIInChI=1S/C8H8O5/c9-6(10)5-3-1-2-4-8(5,13)7(11)12/h1-5,13H,(H,9,10)(H,11,12)
InChIKeyBQIOTSCEOSMFOT-UHFFFAOYSA-N
MW184.15 g/mol
LogP-0.37
Rot. Bonds2

About 1-hydroxycyclohexa-3,5-diene-1,2-dicarboxylic acid

1-hydroxycyclohexa-3,5-diene-1,2-dicarboxylic acid (PubChem CID 22292283) has the molecular formula C8H8O5 and a molecular weight of 184.15 g/mol. Its IUPAC name is 1-hydroxycyclohexa-3,5-diene-1,2-dicarboxylic acid.

Molecular Properties

Compound Name1-hydroxycyclohexa-3,5-diene-1,2-dicarboxylic acid
PubChem CID22292283
Molecular FormulaC8H8O5
Molecular Weight184.15 g/mol
Exact Mass184.04
IUPAC Name1-hydroxycyclohexa-3,5-diene-1,2-dicarboxylic acid
SMILESO=C(O)C1C=CC=CC1(O)C(=O)O
InChIInChI=1S/C8H8O5/c9-6(10)5-3-1-2-4-8(5,13)7(11)12/h1-5,13H,(H,9,10)(H,11,12)
InChIKeyBQIOTSCEOSMFOT-UHFFFAOYSA-N
XLogP-0.37
TPSA94.83 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.15
LogP ≤ 5-0.37
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 1-hydroxycyclohexa-3,5-diene-1,2-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-hydroxycyclohexa-3,5-diene-1,2-dicarboxylic acid?
The IUPAC name of 1-hydroxycyclohexa-3,5-diene-1,2-dicarboxylic acid (CID 22292283) is 1-hydroxycyclohexa-3,5-diene-1,2-dicarboxylic acid.
What is the SMILES notation for 1-hydroxycyclohexa-3,5-diene-1,2-dicarboxylic acid?
The canonical SMILES for 1-hydroxycyclohexa-3,5-diene-1,2-dicarboxylic acid is O=C(O)C1C=CC=CC1(O)C(=O)O.
What is the InChIKey of 1-hydroxycyclohexa-3,5-diene-1,2-dicarboxylic acid?
The InChIKey is BQIOTSCEOSMFOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O5/c9-6(10)5-3-1-2-4-8(5,13)7(11)12/h1-5,13H,(H,9,10)(H,11,12).
What are the key properties of 1-hydroxycyclohexa-3,5-diene-1,2-dicarboxylic acid?
1-hydroxycyclohexa-3,5-diene-1,2-dicarboxylic acid has a molecular weight of 184.15 g/mol, XLogP of -0.37, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxycyclohexa-3,5-diene-1,2-dicarboxylic acid is sourced from PubChem (CID 22292283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).