C15H6F26O2 — CID 22292396
3-[3-[1,1,1,2,2,3,4,5,5,5-decafluoro-4-(trifluoromethyl)pentan-3-yl]oxypropoxy]-1,1,1,2,2,3,4,5,5,5-decafluoro-4-(trifluoromethyl)pentane (PubChem CID 22292396) has the molecular formula C15H6F26O2 and a molecular weight of 712.16 g/mol. Its IUPAC name is 3-[3-[1,1,1,2,2,3,4,5,5,5-decafluoro-4-(trifluoromethyl)pentan-3-yl]oxypropoxy]-1,1,1,2,2,3,4,5,5,5-decafluoro-4-(trifluoromethyl)pentane.
| Compound Name | 3-[3-[1,1,1,2,2,3,4,5,5,5-decafluoro-4-(trifluoromethyl)pentan-3-yl]oxypropoxy]-1,1,1,2,2,3,4,5,5,5-decafluoro-4-(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 22292396 |
| Molecular Formula | C15H6F26O2 |
| Molecular Weight | 712.16 g/mol |
| Exact Mass | 712.00 |
| IUPAC Name | 3-[3-[1,1,1,2,2,3,4,5,5,5-decafluoro-4-(trifluoromethyl)pentan-3-yl]oxypropoxy]-1,1,1,2,2,3,4,5,5,5-decafluoro-4-(trifluoromethyl)pentane |
| SMILES | FC(F)(F)C(F)(F)C(F)(OCCCOC(F)(C(F)(F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H6F26O2/c16-4(10(24,25)26,11(27,28)29)8(22,6(18,19)14(36,37)38)42-2-1-3-43-9(23,7(20,21)15(39,40)41)5(17,12(30,31)32)13(33,34)35/h1-3H2 |
| InChIKey | ZZTGKMKLEJZOIM-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.16 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|