C8H5F11O — CID 22292468
1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-(methoxymethyl)cyclohexane (PubChem CID 22292468) has the molecular formula C8H5F11O and a molecular weight of 326.11 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-(methoxymethyl)cyclohexane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-(methoxymethyl)cyclohexane |
|---|---|
| PubChem CID | 22292468 |
| Molecular Formula | C8H5F11O |
| Molecular Weight | 326.11 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-(methoxymethyl)cyclohexane |
| SMILES | COCC1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8H5F11O/c1-20-2-3(9)4(10,11)6(14,15)8(18,19)7(16,17)5(3,12)13/h2H2,1H3 |
| InChIKey | ZRJZJWLSQLOTIH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.11 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|