C24H30N2O4SSi — CID 22292619
2-(1,3-benzothiazol-6-yl)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-methyl-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 22292619) has the molecular formula C24H30N2O4SSi and a molecular weight of 470.67 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-6-yl)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-methyl-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | 2-(1,3-benzothiazol-6-yl)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-methyl-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 22292619 |
| Molecular Formula | C24H30N2O4SSi |
| Molecular Weight | 470.67 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 2-(1,3-benzothiazol-6-yl)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-methyl-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | CC12C=CC(CCO[Si](C)(C)C(C)(C)C)(O1)C1C(=O)N(c3ccc4ncsc4c3)C(=O)C12 |
| InChI | InChI=1S/C24H30N2O4SSi/c1-22(2,3)32(5,6)29-12-11-24-10-9-23(4,30-24)18-19(24)21(28)26(20(18)27)15-7-8-16-17(13-15)31-14-25-16/h7-10,13-14,18-19H,11-12H2,1-6H3 |
| InChIKey | OQYBTAQDTVQYAE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.67 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|