C16H17ClF3NO2 — CID 22292782
1-(7-chloro-5-methyl-8-prop-2-enoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-2,2,2-trifluoroethanone (PubChem CID 22292782) has the molecular formula C16H17ClF3NO2 and a molecular weight of 347.76 g/mol. Its IUPAC name is 1-(7-chloro-5-methyl-8-prop-2-enoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(7-chloro-5-methyl-8-prop-2-enoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 22292782 |
| Molecular Formula | C16H17ClF3NO2 |
| Molecular Weight | 347.76 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 1-(7-chloro-5-methyl-8-prop-2-enoxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-2,2,2-trifluoroethanone |
| SMILES | C=CCOc1cc2c(cc1Cl)C(C)CN(C(=O)C(F)(F)F)CC2 |
| InChI | InChI=1S/C16H17ClF3NO2/c1-3-6-23-14-7-11-4-5-21(15(22)16(18,19)20)9-10(2)12(11)8-13(14)17/h3,7-8,10H,1,4-6,9H2,2H3 |
| InChIKey | NAXOFONNXWIQOK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.76 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|