C25H24F6O2 — CID 22293462
8-[(E)-3-[3,5-bis(trifluoromethyl)phenyl]prop-1-enyl]-8-phenyl-1,4-dioxaspiro[4.5]decane (PubChem CID 22293462) has the molecular formula C25H24F6O2 and a molecular weight of 470.45 g/mol. Its IUPAC name is 8-[(E)-3-[3,5-bis(trifluoromethyl)phenyl]prop-1-enyl]-8-phenyl-1,4-dioxaspiro[4.5]decane.
| Compound Name | 8-[(E)-3-[3,5-bis(trifluoromethyl)phenyl]prop-1-enyl]-8-phenyl-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 22293462 |
| Molecular Formula | C25H24F6O2 |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 8-[(E)-3-[3,5-bis(trifluoromethyl)phenyl]prop-1-enyl]-8-phenyl-1,4-dioxaspiro[4.5]decane |
| SMILES | FC(F)(F)c1cc(C/C=C/C2(c3ccccc3)CCC3(CC2)OCCO3)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H24F6O2/c26-24(27,28)20-15-18(16-21(17-20)25(29,30)31)5-4-8-22(19-6-2-1-3-7-19)9-11-23(12-10-22)32-13-14-33-23/h1-4,6-8,15-17H,5,9-14H2/b8-4+ |
| InChIKey | RFXDWLHIQXWVNC-XBXARRHUSA-N |
| XLogP | 7.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|