C15H36O5Si3 — CID 22294782
[(2R,3R,4R,5S)-5-methoxy-3,4-bis(trimethylsilyloxy)oxolan-2-yl]methoxy-trimethylsilane (PubChem CID 22294782) has the molecular formula C15H36O5Si3 and a molecular weight of 380.71 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-5-methoxy-3,4-bis(trimethylsilyloxy)oxolan-2-yl]methoxy-trimethylsilane.
| Compound Name | [(2R,3R,4R,5S)-5-methoxy-3,4-bis(trimethylsilyloxy)oxolan-2-yl]methoxy-trimethylsilane |
|---|---|
| PubChem CID | 22294782 |
| Molecular Formula | C15H36O5Si3 |
| Molecular Weight | 380.71 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | [(2R,3R,4R,5S)-5-methoxy-3,4-bis(trimethylsilyloxy)oxolan-2-yl]methoxy-trimethylsilane |
| SMILES | CO[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C15H36O5Si3/c1-16-15-14(20-23(8,9)10)13(19-22(5,6)7)12(18-15)11-17-21(2,3)4/h12-15H,11H2,1-10H3/t12-,13-,14-,15+/m1/s1 |
| InChIKey | WZJRJUAWWFXXSN-TUVASFSCSA-N |
| XLogP | 3.65 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.71 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|