C14H18F3NO3Si — CID 22294845
trimethylsilyl (2S)-3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate (PubChem CID 22294845) has the molecular formula C14H18F3NO3Si and a molecular weight of 333.38 g/mol. Its IUPAC name is trimethylsilyl (2S)-3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate.
| Compound Name | trimethylsilyl (2S)-3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
|---|---|
| PubChem CID | 22294845 |
| Molecular Formula | C14H18F3NO3Si |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | trimethylsilyl (2S)-3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
| SMILES | C[Si](C)(C)OC(=O)[C@H](Cc1ccccc1)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C14H18F3NO3Si/c1-22(2,3)21-12(19)11(18-13(20)14(15,16)17)9-10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3,(H,18,20)/t11-/m0/s1 |
| InChIKey | MRVDKKCSXVEZMU-NSHDSACASA-N |
| XLogP | 2.65 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|