C15H18N2O5 — CID 22295181
dimethyl (1R,5S,6S)-5-ethoxy-3,4-diazatricyclo[4.4.1.01,6]undeca-2,7,9-triene-2,5-dicarboxylate (PubChem CID 22295181) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is dimethyl (1R,5S,6S)-5-ethoxy-3,4-diazatricyclo[4.4.1.01,6]undeca-2,7,9-triene-2,5-dicarboxylate.
| Compound Name | dimethyl (1R,5S,6S)-5-ethoxy-3,4-diazatricyclo[4.4.1.01,6]undeca-2,7,9-triene-2,5-dicarboxylate |
|---|---|
| PubChem CID | 22295181 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | dimethyl (1R,5S,6S)-5-ethoxy-3,4-diazatricyclo[4.4.1.01,6]undeca-2,7,9-triene-2,5-dicarboxylate |
| SMILES | CCO[C@@]1(C(=O)OC)NN=C(C(=O)OC)[C@]23C=CC=C[C@@]21C3 |
| InChI | InChI=1S/C15H18N2O5/c1-4-22-15(12(19)21-3)14-8-6-5-7-13(14,9-14)10(16-17-15)11(18)20-2/h5-8,17H,4,9H2,1-3H3/t13-,14-,15-/m1/s1 |
| InChIKey | WKHZMBSOPVEKHZ-RBSFLKMASA-N |
| XLogP | 0.53 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |