C22H30O3 — CID 22295951
[(4bS,8aS)-4b,8,8-trimethyl-5-oxo-1-propan-2-yl-7,8a,9,10-tetrahydro-6H-phenanthren-2-yl] acetate (PubChem CID 22295951) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is [(4bS,8aS)-4b,8,8-trimethyl-5-oxo-1-propan-2-yl-7,8a,9,10-tetrahydro-6H-phenanthren-2-yl] acetate.
| Compound Name | [(4bS,8aS)-4b,8,8-trimethyl-5-oxo-1-propan-2-yl-7,8a,9,10-tetrahydro-6H-phenanthren-2-yl] acetate |
|---|---|
| PubChem CID | 22295951 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | [(4bS,8aS)-4b,8,8-trimethyl-5-oxo-1-propan-2-yl-7,8a,9,10-tetrahydro-6H-phenanthren-2-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1C(C)C)CC[C@H]1C(C)(C)CCC(=O)[C@]21C |
| InChI | InChI=1S/C22H30O3/c1-13(2)20-15-7-10-18-21(4,5)12-11-19(24)22(18,6)16(15)8-9-17(20)25-14(3)23/h8-9,13,18H,7,10-12H2,1-6H3/t18-,22+/m0/s1 |
| InChIKey | SZDQHDBKPJGBOR-PGRDOPGGSA-N |
| XLogP | 4.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|