C15H7Cl4O2- — CID 22296231
2,7,9,9-tetrachloro-1-methylfluorene-4-carboxylate (PubChem CID 22296231) has the molecular formula C15H7Cl4O2- and a molecular weight of 361.03 g/mol. Its IUPAC name is 2,7,9,9-tetrachloro-1-methylfluorene-4-carboxylate.
| Compound Name | 2,7,9,9-tetrachloro-1-methylfluorene-4-carboxylate |
|---|---|
| PubChem CID | 22296231 |
| Molecular Formula | C15H7Cl4O2- |
| Molecular Weight | 361.03 g/mol |
| Exact Mass | 358.92 |
| IUPAC Name | 2,7,9,9-tetrachloro-1-methylfluorene-4-carboxylate |
| SMILES | Cc1c(Cl)cc(C(=O)[O-])c2c1C(Cl)(Cl)c1cc(Cl)ccc1-2 |
| InChI | InChI=1S/C15H8Cl4O2/c1-6-11(17)5-9(14(20)21)12-8-3-2-7(16)4-10(8)15(18,19)13(6)12/h2-5H,1H3,(H,20,21)/p-1 |
| InChIKey | AZZZEFWDTFNWQE-UHFFFAOYSA-M |
| XLogP | 4.32 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.03 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|