C22H21NO4 — CID 22296536
2,3,10,11-tetramethoxy-8-methylbenzo[a]phenanthridine (PubChem CID 22296536) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is 2,3,10,11-tetramethoxy-8-methylbenzo[a]phenanthridine.
| Compound Name | 2,3,10,11-tetramethoxy-8-methylbenzo[a]phenanthridine |
|---|---|
| PubChem CID | 22296536 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 2,3,10,11-tetramethoxy-8-methylbenzo[a]phenanthridine |
| SMILES | COc1cc2cnc3cc(C)c4cc(OC)c(OC)cc4c3c2cc1OC |
| InChI | InChI=1S/C22H21NO4/c1-12-6-17-22(16-10-21(27-5)19(25-3)8-14(12)16)15-9-20(26-4)18(24-2)7-13(15)11-23-17/h6-11H,1-5H3 |
| InChIKey | FBESQBJUHLJLDZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|