C29H46O3 — CID 22296688
[(1R,2S,4S,7S,8R,9S,12S,13S)-7,9,13-trimethyl-6-(3-methylbut-3-enyl)-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl] acetate (PubChem CID 22296688) has the molecular formula C29H46O3 and a molecular weight of 442.68 g/mol. Its IUPAC name is [(1R,2S,4S,7S,8R,9S,12S,13S)-7,9,13-trimethyl-6-(3-methylbut-3-enyl)-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl] acetate.
| Compound Name | [(1R,2S,4S,7S,8R,9S,12S,13S)-7,9,13-trimethyl-6-(3-methylbut-3-enyl)-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl] acetate |
|---|---|
| PubChem CID | 22296688 |
| Molecular Formula | C29H46O3 |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 442.34 |
| IUPAC Name | [(1R,2S,4S,7S,8R,9S,12S,13S)-7,9,13-trimethyl-6-(3-methylbut-3-enyl)-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl] acetate |
| SMILES | C=C(C)CCC1O[C@H]2C[C@H]3[C@@H]4CCC5CC(OC(C)=O)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]2[C@@H]1C |
| InChI | InChI=1S/C29H46O3/c1-17(2)7-10-25-18(3)27-26(32-25)16-24-22-9-8-20-15-21(31-19(4)30)11-13-28(20,5)23(22)12-14-29(24,27)6/h18,20-27H,1,7-16H2,2-6H3/t18-,20?,21?,22-,23+,24+,25?,26+,27+,28+,29+/m1/s1 |
| InChIKey | PZOPBAJBWUHJQE-KELMVPJOSA-N |
| XLogP | 6.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|