C27H45IO2 — CID 22296951
acetic acid;17-(1-iodopropan-2-yl)-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 22296951) has the molecular formula C27H45IO2 and a molecular weight of 528.56 g/mol. Its IUPAC name is acetic acid;17-(1-iodopropan-2-yl)-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | acetic acid;17-(1-iodopropan-2-yl)-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 22296951 |
| Molecular Formula | C27H45IO2 |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | acetic acid;17-(1-iodopropan-2-yl)-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC(=O)O.CC(CI)C1CCC2(C)C3=C(CCC12C)C1(C)CCCC(C)(C)C1CC3 |
| InChI | InChI=1S/C25H41I.C2H4O2/c1-17(16-26)18-10-14-25(6)20-8-9-21-22(2,3)12-7-13-23(21,4)19(20)11-15-24(18,25)5;1-2(3)4/h17-18,21H,7-16H2,1-6H3;1H3,(H,3,4) |
| InChIKey | CRESUQYCYNWVED-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|