C26H45NO3 — CID 22297328
[(2R,3S,5R)-5-(5-hydroxyoctyl)-2-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-3-yl] (2E,4E)-octa-2,4-dienoate (PubChem CID 22297328) has the molecular formula C26H45NO3 and a molecular weight of 419.65 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(5-hydroxyoctyl)-2-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-3-yl] (2E,4E)-octa-2,4-dienoate.
| Compound Name | [(2R,3S,5R)-5-(5-hydroxyoctyl)-2-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-3-yl] (2E,4E)-octa-2,4-dienoate |
|---|---|
| PubChem CID | 22297328 |
| Molecular Formula | C26H45NO3 |
| Molecular Weight | 419.65 g/mol |
| Exact Mass | 419.34 |
| IUPAC Name | [(2R,3S,5R)-5-(5-hydroxyoctyl)-2-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-3-yl] (2E,4E)-octa-2,4-dienoate |
| SMILES | CCC/C=C/C=C/C(=O)O[C@H]1CC2C(CCC[C@H]2CCCCC(O)CCC)N[C@@H]1C |
| InChI | InChI=1S/C26H45NO3/c1-4-6-7-8-9-18-26(29)30-25-19-23-21(14-10-11-16-22(28)13-5-2)15-12-17-24(23)27-20(25)3/h7-9,18,20-25,27-28H,4-6,10-17,19H2,1-3H3/b8-7+,18-9+/t20-,21-,22?,23?,24?,25+/m1/s1 |
| InChIKey | RLTXIRPCJHXWEP-WEWLUPOXSA-N |
| XLogP | 5.70 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.65 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|