About 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-(4-sulfamoylphenyl)acetamide
2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-(4-sulfamoylphenyl)acetamide (PubChem CID 2229752) has the molecular formula C16H14ClN3O5S
and a molecular weight of 395.82 g/mol. Its IUPAC name is 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-(4-sulfamoylphenyl)acetamide.
Molecular Properties
| Compound Name | 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-(4-sulfamoylphenyl)acetamide |
| PubChem CID | 2229752 |
| Molecular Formula | C16H14ClN3O5S |
| Molecular Weight | 395.82 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-(4-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CN2C(=O)COc3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C16H14ClN3O5S/c17-10-1-6-14-13(7-10)20(16(22)9-25-14)8-15(21)19-11-2-4-12(5-3-11)26(18,23)24/h1-7H,8-9H2,(H,19,21)(H2,18,23,24) |
| InChIKey | NRAQATONRXEMJO-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.82 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-(4-sulfamoylphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-(4-sulfamoylphenyl)acetamide?
The IUPAC name of 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-(4-sulfamoylphenyl)acetamide (CID 2229752) is 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-(4-sulfamoylphenyl)acetamide.
What is the SMILES notation for 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-(4-sulfamoylphenyl)acetamide?
The canonical SMILES for 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-(4-sulfamoylphenyl)acetamide is NS(=O)(=O)c1ccc(NC(=O)CN2C(=O)COc3ccc(Cl)cc32)cc1.
What is the InChIKey of 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-(4-sulfamoylphenyl)acetamide?
The InChIKey is NRAQATONRXEMJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClN3O5S/c17-10-1-6-14-13(7-10)20(16(22)9-25-14)8-15(21)19-11-2-4-12(5-3-11)26(18,23)24/h1-7H,8-9H2,(H,19,21)(H2,18,23,24).
What are the key properties of 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-(4-sulfamoylphenyl)acetamide?
2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-(4-sulfamoylphenyl)acetamide has a molecular weight of 395.82 g/mol, XLogP of 1.35, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-(4-sulfamoylphenyl)acetamide is sourced from PubChem (CID 2229752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).