C15H16O4 — CID 22297544
3,6,9-trimethyl-3a,5,9a,9b-tetrahydro-3H-azuleno[4,5-b]furan-2,4,7-trione (PubChem CID 22297544) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is 3,6,9-trimethyl-3a,5,9a,9b-tetrahydro-3H-azuleno[4,5-b]furan-2,4,7-trione.
| Compound Name | 3,6,9-trimethyl-3a,5,9a,9b-tetrahydro-3H-azuleno[4,5-b]furan-2,4,7-trione |
|---|---|
| PubChem CID | 22297544 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 3,6,9-trimethyl-3a,5,9a,9b-tetrahydro-3H-azuleno[4,5-b]furan-2,4,7-trione |
| SMILES | CC1=CC(=O)C2=C(C)CC(=O)C3C(C)C(=O)OC3C12 |
| InChI | InChI=1S/C15H16O4/c1-6-4-10(17)13-8(3)15(18)19-14(13)12-7(2)5-9(16)11(6)12/h5,8,12-14H,4H2,1-3H3 |
| InChIKey | JFFMMLPJMYOOOM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |