About trimethylsilyl 2-isocyanato-1,2-dimethylcyclopropane-1-carboxylate
trimethylsilyl 2-isocyanato-1,2-dimethylcyclopropane-1-carboxylate (PubChem CID 22297803) has the molecular formula C10H17NO3Si
and a molecular weight of 227.34 g/mol. Its IUPAC name is trimethylsilyl 2-isocyanato-1,2-dimethylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | trimethylsilyl 2-isocyanato-1,2-dimethylcyclopropane-1-carboxylate |
| PubChem CID | 22297803 |
| Molecular Formula | C10H17NO3Si |
| Molecular Weight | 227.34 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | trimethylsilyl 2-isocyanato-1,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(N=C=O)CC1(C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C10H17NO3Si/c1-9(6-10(9,2)11-7-12)8(13)14-15(3,4)5/h6H2,1-5H3 |
| InChIKey | XSNXOMOXEBTPTJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze trimethylsilyl 2-isocyanato-1,2-dimethylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylsilyl 2-isocyanato-1,2-dimethylcyclopropane-1-carboxylate?
The IUPAC name of trimethylsilyl 2-isocyanato-1,2-dimethylcyclopropane-1-carboxylate (CID 22297803) is trimethylsilyl 2-isocyanato-1,2-dimethylcyclopropane-1-carboxylate.
What is the SMILES notation for trimethylsilyl 2-isocyanato-1,2-dimethylcyclopropane-1-carboxylate?
The canonical SMILES for trimethylsilyl 2-isocyanato-1,2-dimethylcyclopropane-1-carboxylate is CC1(N=C=O)CC1(C)C(=O)O[Si](C)(C)C.
What is the InChIKey of trimethylsilyl 2-isocyanato-1,2-dimethylcyclopropane-1-carboxylate?
The InChIKey is XSNXOMOXEBTPTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO3Si/c1-9(6-10(9,2)11-7-12)8(13)14-15(3,4)5/h6H2,1-5H3.
What are the key properties of trimethylsilyl 2-isocyanato-1,2-dimethylcyclopropane-1-carboxylate?
trimethylsilyl 2-isocyanato-1,2-dimethylcyclopropane-1-carboxylate has a molecular weight of 227.34 g/mol, XLogP of 1.87, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylsilyl 2-isocyanato-1,2-dimethylcyclopropane-1-carboxylate is sourced from PubChem (CID 22297803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).