C27H46N2O2 — CID 22297916
(7R,10R,14R,16R,20S,22R,24S)-7-amino-10,14,16,20-tetramethyl-23-oxa-18-azahexacyclo[12.11.0.02,11.05,10.015,24.017,22]pentacosan-22-ol (PubChem CID 22297916) has the molecular formula C27H46N2O2 and a molecular weight of 430.68 g/mol. Its IUPAC name is (7R,10R,14R,16R,20S,22R,24S)-7-amino-10,14,16,20-tetramethyl-23-oxa-18-azahexacyclo[12.11.0.02,11.05,10.015,24.017,22]pentacosan-22-ol.
| Compound Name | (7R,10R,14R,16R,20S,22R,24S)-7-amino-10,14,16,20-tetramethyl-23-oxa-18-azahexacyclo[12.11.0.02,11.05,10.015,24.017,22]pentacosan-22-ol |
|---|---|
| PubChem CID | 22297916 |
| Molecular Formula | C27H46N2O2 |
| Molecular Weight | 430.68 g/mol |
| Exact Mass | 430.36 |
| IUPAC Name | (7R,10R,14R,16R,20S,22R,24S)-7-amino-10,14,16,20-tetramethyl-23-oxa-18-azahexacyclo[12.11.0.02,11.05,10.015,24.017,22]pentacosan-22-ol |
| SMILES | CC1C2[C@H](CC3C4CCC5C[C@H](N)CC[C@@]5(C)C4CC[C@]32C)O[C@]2(O)C[C@H](C)CNC12 |
| InChI | InChI=1S/C27H46N2O2/c1-15-13-27(30)24(29-14-15)16(2)23-22(31-27)12-21-19-6-5-17-11-18(28)7-9-25(17,3)20(19)8-10-26(21,23)4/h15-24,29-30H,5-14,28H2,1-4H3/t15-,16?,17?,18+,19?,20?,21?,22-,23?,24?,25+,26+,27+/m0/s1 |
| InChIKey | ZPTJKUUQUDRHTL-KNFGLBHESA-N |
| XLogP | 4.30 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.68 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |