About piperidine-4-carboxylic acid;hydrochloride
piperidine-4-carboxylic acid;hydrochloride (PubChem CID 22298) has the molecular formula C6H12ClNO2
and a molecular weight of 165.62 g/mol. Its IUPAC name is piperidine-4-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | piperidine-4-carboxylic acid;hydrochloride |
| PubChem CID | 22298 |
| Molecular Formula | C6H12ClNO2 |
| Molecular Weight | 165.62 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | piperidine-4-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)C1CCNCC1 |
| InChI | InChI=1S/C6H11NO2.ClH/c8-6(9)5-1-3-7-4-2-5;/h5,7H,1-4H2,(H,8,9);1H |
| InChIKey | NVUYWKBRSRPYMH-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.62 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze piperidine-4-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidine-4-carboxylic acid;hydrochloride?
The IUPAC name of piperidine-4-carboxylic acid;hydrochloride (CID 22298) is piperidine-4-carboxylic acid;hydrochloride.
What is the SMILES notation for piperidine-4-carboxylic acid;hydrochloride?
The canonical SMILES for piperidine-4-carboxylic acid;hydrochloride is Cl.O=C(O)C1CCNCC1.
What is the InChIKey of piperidine-4-carboxylic acid;hydrochloride?
The InChIKey is NVUYWKBRSRPYMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2.ClH/c8-6(9)5-1-3-7-4-2-5;/h5,7H,1-4H2,(H,8,9);1H.
What are the key properties of piperidine-4-carboxylic acid;hydrochloride?
piperidine-4-carboxylic acid;hydrochloride has a molecular weight of 165.62 g/mol, XLogP of 0.49, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine-4-carboxylic acid;hydrochloride is sourced from PubChem (CID 22298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).