C10H14O4 — CID 22298113
(3aR,4S,7aS)-4-hydroxy-2,2,6-trimethyl-4,7a-dihydro-3aH-1,3-benzodioxol-5-one (PubChem CID 22298113) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is (3aR,4S,7aS)-4-hydroxy-2,2,6-trimethyl-4,7a-dihydro-3aH-1,3-benzodioxol-5-one.
| Compound Name | (3aR,4S,7aS)-4-hydroxy-2,2,6-trimethyl-4,7a-dihydro-3aH-1,3-benzodioxol-5-one |
|---|---|
| PubChem CID | 22298113 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (3aR,4S,7aS)-4-hydroxy-2,2,6-trimethyl-4,7a-dihydro-3aH-1,3-benzodioxol-5-one |
| SMILES | CC1=C[C@@H]2OC(C)(C)O[C@@H]2[C@H](O)C1=O |
| InChI | InChI=1S/C10H14O4/c1-5-4-6-9(8(12)7(5)11)14-10(2,3)13-6/h4,6,8-9,12H,1-3H3/t6-,8+,9-/m0/s1 |
| InChIKey | JAWPESHUBVPFNL-ZQARSLAVSA-N |
| XLogP | 0.40 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |