C16H17F3INO2 — CID 22298114
2,2,2-trifluoro-N-[(5-iodo-3,4-dihydro-2H-pyran-2-yl)methyl]-N-(1-phenylethyl)acetamide (PubChem CID 22298114) has the molecular formula C16H17F3INO2 and a molecular weight of 439.22 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(5-iodo-3,4-dihydro-2H-pyran-2-yl)methyl]-N-(1-phenylethyl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(5-iodo-3,4-dihydro-2H-pyran-2-yl)methyl]-N-(1-phenylethyl)acetamide |
|---|---|
| PubChem CID | 22298114 |
| Molecular Formula | C16H17F3INO2 |
| Molecular Weight | 439.22 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | 2,2,2-trifluoro-N-[(5-iodo-3,4-dihydro-2H-pyran-2-yl)methyl]-N-(1-phenylethyl)acetamide |
| SMILES | CC(c1ccccc1)N(CC1CCC(I)=CO1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C16H17F3INO2/c1-11(12-5-3-2-4-6-12)21(15(22)16(17,18)19)9-14-8-7-13(20)10-23-14/h2-6,10-11,14H,7-9H2,1H3 |
| InChIKey | QCXJHOQPGUOJMB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.22 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|