About tert-butyl-[[(2R,5S)-5-methoxy-3-methylideneoxolan-2-yl]methoxy]-dimethylsilane
tert-butyl-[[(2R,5S)-5-methoxy-3-methylideneoxolan-2-yl]methoxy]-dimethylsilane (PubChem CID 22298162) has the molecular formula C13H26O3Si
and a molecular weight of 258.43 g/mol. Its IUPAC name is tert-butyl-[[(2R,5S)-5-methoxy-3-methylideneoxolan-2-yl]methoxy]-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[[(2R,5S)-5-methoxy-3-methylideneoxolan-2-yl]methoxy]-dimethylsilane |
| PubChem CID | 22298162 |
| Molecular Formula | C13H26O3Si |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | tert-butyl-[[(2R,5S)-5-methoxy-3-methylideneoxolan-2-yl]methoxy]-dimethylsilane |
| SMILES | C=C1C[C@@H](OC)O[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H26O3Si/c1-10-8-12(14-5)16-11(10)9-15-17(6,7)13(2,3)4/h11-12H,1,8-9H2,2-7H3/t11-,12-/m0/s1 |
| InChIKey | YWMSVZDHXDVKEQ-RYUDHWBXSA-N |
| XLogP | 3.33 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[[(2R,5S)-5-methoxy-3-methylideneoxolan-2-yl]methoxy]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[[(2R,5S)-5-methoxy-3-methylideneoxolan-2-yl]methoxy]-dimethylsilane?
The IUPAC name of tert-butyl-[[(2R,5S)-5-methoxy-3-methylideneoxolan-2-yl]methoxy]-dimethylsilane (CID 22298162) is tert-butyl-[[(2R,5S)-5-methoxy-3-methylideneoxolan-2-yl]methoxy]-dimethylsilane.
What is the SMILES notation for tert-butyl-[[(2R,5S)-5-methoxy-3-methylideneoxolan-2-yl]methoxy]-dimethylsilane?
The canonical SMILES for tert-butyl-[[(2R,5S)-5-methoxy-3-methylideneoxolan-2-yl]methoxy]-dimethylsilane is C=C1C[C@@H](OC)O[C@H]1CO[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-[[(2R,5S)-5-methoxy-3-methylideneoxolan-2-yl]methoxy]-dimethylsilane?
The InChIKey is YWMSVZDHXDVKEQ-RYUDHWBXSA-N. The full InChI is InChI=1S/C13H26O3Si/c1-10-8-12(14-5)16-11(10)9-15-17(6,7)13(2,3)4/h11-12H,1,8-9H2,2-7H3/t11-,12-/m0/s1.
What are the key properties of tert-butyl-[[(2R,5S)-5-methoxy-3-methylideneoxolan-2-yl]methoxy]-dimethylsilane?
tert-butyl-[[(2R,5S)-5-methoxy-3-methylideneoxolan-2-yl]methoxy]-dimethylsilane has a molecular weight of 258.43 g/mol, XLogP of 3.33, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[[(2R,5S)-5-methoxy-3-methylideneoxolan-2-yl]methoxy]-dimethylsilane is sourced from PubChem (CID 22298162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).