About N-(2-phenoxyethyl)-1H-1,2,4-triazole-5-carboxamide
N-(2-phenoxyethyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 2229845) has the molecular formula C11H12N4O2
and a molecular weight of 232.24 g/mol. Its IUPAC name is N-(2-phenoxyethyl)-1H-1,2,4-triazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(2-phenoxyethyl)-1H-1,2,4-triazole-5-carboxamide |
| PubChem CID | 2229845 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | N-(2-phenoxyethyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | O=C(NCCOc1ccccc1)c1ncn[nH]1 |
| InChI | InChI=1S/C11H12N4O2/c16-11(10-13-8-14-15-10)12-6-7-17-9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H,12,16)(H,13,14,15) |
| InChIKey | ZINLFCBRSAHZFK-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-phenoxyethyl)-1H-1,2,4-triazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-phenoxyethyl)-1H-1,2,4-triazole-5-carboxamide?
The IUPAC name of N-(2-phenoxyethyl)-1H-1,2,4-triazole-5-carboxamide (CID 2229845) is N-(2-phenoxyethyl)-1H-1,2,4-triazole-5-carboxamide.
What is the SMILES notation for N-(2-phenoxyethyl)-1H-1,2,4-triazole-5-carboxamide?
The canonical SMILES for N-(2-phenoxyethyl)-1H-1,2,4-triazole-5-carboxamide is O=C(NCCOc1ccccc1)c1ncn[nH]1.
What is the InChIKey of N-(2-phenoxyethyl)-1H-1,2,4-triazole-5-carboxamide?
The InChIKey is ZINLFCBRSAHZFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O2/c16-11(10-13-8-14-15-10)12-6-7-17-9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H,12,16)(H,13,14,15).
What are the key properties of N-(2-phenoxyethyl)-1H-1,2,4-triazole-5-carboxamide?
N-(2-phenoxyethyl)-1H-1,2,4-triazole-5-carboxamide has a molecular weight of 232.24 g/mol, XLogP of 0.61, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-phenoxyethyl)-1H-1,2,4-triazole-5-carboxamide is sourced from PubChem (CID 2229845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).