C15H13N3O2S — CID 22298708
[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-pyridin-3-ylmethanethiol (PubChem CID 22298708) has the molecular formula C15H13N3O2S and a molecular weight of 299.36 g/mol. Its IUPAC name is [5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-pyridin-3-ylmethanethiol.
| Compound Name | [5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-pyridin-3-ylmethanethiol |
|---|---|
| PubChem CID | 22298708 |
| Molecular Formula | C15H13N3O2S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | [5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-pyridin-3-ylmethanethiol |
| SMILES | COc1cccc(-c2nnc(C(S)c3cccnc3)o2)c1 |
| InChI | InChI=1S/C15H13N3O2S/c1-19-12-6-2-4-10(8-12)14-17-18-15(20-14)13(21)11-5-3-7-16-9-11/h2-9,13,21H,1H3 |
| InChIKey | CCMWZFJYGOBADU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 61.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|