About N-[(E)-(1,2-dimethylindol-3-yl)methylideneamino]-5-methyl-1H-pyrazole-3-carboxamide
N-[(E)-(1,2-dimethylindol-3-yl)methylideneamino]-5-methyl-1H-pyrazole-3-carboxamide (PubChem CID 22299254) has the molecular formula C16H17N5O
and a molecular weight of 295.35 g/mol. Its IUPAC name is N-[(E)-(1,2-dimethylindol-3-yl)methylideneamino]-5-methyl-1H-pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | N-[(E)-(1,2-dimethylindol-3-yl)methylideneamino]-5-methyl-1H-pyrazole-3-carboxamide |
| PubChem CID | 22299254 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N-[(E)-(1,2-dimethylindol-3-yl)methylideneamino]-5-methyl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N/N=C/c2c(C)n(C)c3ccccc23)n[nH]1 |
| InChI | InChI=1S/C16H17N5O/c1-10-8-14(19-18-10)16(22)20-17-9-13-11(2)21(3)15-7-5-4-6-12(13)15/h4-9H,1-3H3,(H,18,19)(H,20,22)/b17-9+ |
| InChIKey | XMGDASBBJDINJW-RQZCQDPDSA-N |
| XLogP | 2.28 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-(1,2-dimethylindol-3-yl)methylideneamino]-5-methyl-1H-pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-(1,2-dimethylindol-3-yl)methylideneamino]-5-methyl-1H-pyrazole-3-carboxamide?
The IUPAC name of N-[(E)-(1,2-dimethylindol-3-yl)methylideneamino]-5-methyl-1H-pyrazole-3-carboxamide (CID 22299254) is N-[(E)-(1,2-dimethylindol-3-yl)methylideneamino]-5-methyl-1H-pyrazole-3-carboxamide.
What is the SMILES notation for N-[(E)-(1,2-dimethylindol-3-yl)methylideneamino]-5-methyl-1H-pyrazole-3-carboxamide?
The canonical SMILES for N-[(E)-(1,2-dimethylindol-3-yl)methylideneamino]-5-methyl-1H-pyrazole-3-carboxamide is Cc1cc(C(=O)N/N=C/c2c(C)n(C)c3ccccc23)n[nH]1.
What is the InChIKey of N-[(E)-(1,2-dimethylindol-3-yl)methylideneamino]-5-methyl-1H-pyrazole-3-carboxamide?
The InChIKey is XMGDASBBJDINJW-RQZCQDPDSA-N. The full InChI is InChI=1S/C16H17N5O/c1-10-8-14(19-18-10)16(22)20-17-9-13-11(2)21(3)15-7-5-4-6-12(13)15/h4-9H,1-3H3,(H,18,19)(H,20,22)/b17-9+.
What are the key properties of N-[(E)-(1,2-dimethylindol-3-yl)methylideneamino]-5-methyl-1H-pyrazole-3-carboxamide?
N-[(E)-(1,2-dimethylindol-3-yl)methylideneamino]-5-methyl-1H-pyrazole-3-carboxamide has a molecular weight of 295.35 g/mol, XLogP of 2.28, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-(1,2-dimethylindol-3-yl)methylideneamino]-5-methyl-1H-pyrazole-3-carboxamide is sourced from PubChem (CID 22299254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).