About 3-(3,5-dichloroanilino)-1-thiophen-2-ylpropan-1-one
3-(3,5-dichloroanilino)-1-thiophen-2-ylpropan-1-one (PubChem CID 2230040) has the molecular formula C13H11Cl2NOS
and a molecular weight of 300.21 g/mol. Its IUPAC name is 3-(3,5-dichloroanilino)-1-thiophen-2-ylpropan-1-one.
Molecular Properties
| Compound Name | 3-(3,5-dichloroanilino)-1-thiophen-2-ylpropan-1-one |
| PubChem CID | 2230040 |
| Molecular Formula | C13H11Cl2NOS |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | 3-(3,5-dichloroanilino)-1-thiophen-2-ylpropan-1-one |
| SMILES | O=C(CCNc1cc(Cl)cc(Cl)c1)c1cccs1 |
| InChI | InChI=1S/C13H11Cl2NOS/c14-9-6-10(15)8-11(7-9)16-4-3-12(17)13-2-1-5-18-13/h1-2,5-8,16H,3-4H2 |
| InChIKey | VTBBGYYHFOVPOB-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3,5-dichloroanilino)-1-thiophen-2-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dichloroanilino)-1-thiophen-2-ylpropan-1-one?
The IUPAC name of 3-(3,5-dichloroanilino)-1-thiophen-2-ylpropan-1-one (CID 2230040) is 3-(3,5-dichloroanilino)-1-thiophen-2-ylpropan-1-one.
What is the SMILES notation for 3-(3,5-dichloroanilino)-1-thiophen-2-ylpropan-1-one?
The canonical SMILES for 3-(3,5-dichloroanilino)-1-thiophen-2-ylpropan-1-one is O=C(CCNc1cc(Cl)cc(Cl)c1)c1cccs1.
What is the InChIKey of 3-(3,5-dichloroanilino)-1-thiophen-2-ylpropan-1-one?
The InChIKey is VTBBGYYHFOVPOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11Cl2NOS/c14-9-6-10(15)8-11(7-9)16-4-3-12(17)13-2-1-5-18-13/h1-2,5-8,16H,3-4H2.
What are the key properties of 3-(3,5-dichloroanilino)-1-thiophen-2-ylpropan-1-one?
3-(3,5-dichloroanilino)-1-thiophen-2-ylpropan-1-one has a molecular weight of 300.21 g/mol, XLogP of 4.74, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dichloroanilino)-1-thiophen-2-ylpropan-1-one is sourced from PubChem (CID 2230040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).