C14H12Cl2N4O2S — CID 22300619
9-[(3,4-dichlorophenyl)methyl]-1,3-dimethyl-8-sulfanylidene-7H-purine-2,6-dione (PubChem CID 22300619) has the molecular formula C14H12Cl2N4O2S and a molecular weight of 371.25 g/mol. Its IUPAC name is 9-[(3,4-dichlorophenyl)methyl]-1,3-dimethyl-8-sulfanylidene-7H-purine-2,6-dione.
| Compound Name | 9-[(3,4-dichlorophenyl)methyl]-1,3-dimethyl-8-sulfanylidene-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 22300619 |
| Molecular Formula | C14H12Cl2N4O2S |
| Molecular Weight | 371.25 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | 9-[(3,4-dichlorophenyl)methyl]-1,3-dimethyl-8-sulfanylidene-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(=S)n(Cc3ccc(Cl)c(Cl)c3)c2n(C)c1=O |
| InChI | InChI=1S/C14H12Cl2N4O2S/c1-18-11-10(12(21)19(2)14(18)22)17-13(23)20(11)6-7-3-4-8(15)9(16)5-7/h3-5H,6H2,1-2H3,(H,17,23) |
| InChIKey | LFBPANZHSKCIKB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 64.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|