About N-(4-hydroxybutyl)-1,2-dihydroacenaphthylene-5-carboxamide
N-(4-hydroxybutyl)-1,2-dihydroacenaphthylene-5-carboxamide (PubChem CID 2230087) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is N-(4-hydroxybutyl)-1,2-dihydroacenaphthylene-5-carboxamide.
Molecular Properties
| Compound Name | N-(4-hydroxybutyl)-1,2-dihydroacenaphthylene-5-carboxamide |
| PubChem CID | 2230087 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N-(4-hydroxybutyl)-1,2-dihydroacenaphthylene-5-carboxamide |
| SMILES | O=C(NCCCCO)c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C17H19NO2/c19-11-2-1-10-18-17(20)15-9-8-13-7-6-12-4-3-5-14(15)16(12)13/h3-5,8-9,19H,1-2,6-7,10-11H2,(H,18,20) |
| InChIKey | IGZPULHXBMLGER-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(4-hydroxybutyl)-1,2-dihydroacenaphthylene-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-hydroxybutyl)-1,2-dihydroacenaphthylene-5-carboxamide?
The IUPAC name of N-(4-hydroxybutyl)-1,2-dihydroacenaphthylene-5-carboxamide (CID 2230087) is N-(4-hydroxybutyl)-1,2-dihydroacenaphthylene-5-carboxamide.
What is the SMILES notation for N-(4-hydroxybutyl)-1,2-dihydroacenaphthylene-5-carboxamide?
The canonical SMILES for N-(4-hydroxybutyl)-1,2-dihydroacenaphthylene-5-carboxamide is O=C(NCCCCO)c1ccc2c3c(cccc13)CC2.
What is the InChIKey of N-(4-hydroxybutyl)-1,2-dihydroacenaphthylene-5-carboxamide?
The InChIKey is IGZPULHXBMLGER-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2/c19-11-2-1-10-18-17(20)15-9-8-13-7-6-12-4-3-5-14(15)16(12)13/h3-5,8-9,19H,1-2,6-7,10-11H2,(H,18,20).
What are the key properties of N-(4-hydroxybutyl)-1,2-dihydroacenaphthylene-5-carboxamide?
N-(4-hydroxybutyl)-1,2-dihydroacenaphthylene-5-carboxamide has a molecular weight of 269.34 g/mol, XLogP of 2.44, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-hydroxybutyl)-1,2-dihydroacenaphthylene-5-carboxamide is sourced from PubChem (CID 2230087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).