C21H26N2O2S — CID 22300917
N-[2-[benzyl(cyclohexyl)amino]-2-oxoethyl]-5-methylthiophene-2-carboxamide (PubChem CID 22300917) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is N-[2-[benzyl(cyclohexyl)amino]-2-oxoethyl]-5-methylthiophene-2-carboxamide.
| Compound Name | N-[2-[benzyl(cyclohexyl)amino]-2-oxoethyl]-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 22300917 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | N-[2-[benzyl(cyclohexyl)amino]-2-oxoethyl]-5-methylthiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NCC(=O)N(Cc2ccccc2)C2CCCCC2)s1 |
| InChI | InChI=1S/C21H26N2O2S/c1-16-12-13-19(26-16)21(25)22-14-20(24)23(18-10-6-3-7-11-18)15-17-8-4-2-5-9-17/h2,4-5,8-9,12-13,18H,3,6-7,10-11,14-15H2,1H3,(H,22,25) |
| InChIKey | JFVSKTKTYTZTNN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |