About 1-[(4,5-dimethylthiophene-3-carbonyl)amino]-1-(2-methylpropyl)thiourea
1-[(4,5-dimethylthiophene-3-carbonyl)amino]-1-(2-methylpropyl)thiourea (PubChem CID 22301209) has the molecular formula C12H19N3OS2
and a molecular weight of 285.44 g/mol. Its IUPAC name is 1-[(4,5-dimethylthiophene-3-carbonyl)amino]-1-(2-methylpropyl)thiourea.
Molecular Properties
| Compound Name | 1-[(4,5-dimethylthiophene-3-carbonyl)amino]-1-(2-methylpropyl)thiourea |
| PubChem CID | 22301209 |
| Molecular Formula | C12H19N3OS2 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 1-[(4,5-dimethylthiophene-3-carbonyl)amino]-1-(2-methylpropyl)thiourea |
| SMILES | Cc1scc(C(=O)NN(CC(C)C)C(N)=S)c1C |
| InChI | InChI=1S/C12H19N3OS2/c1-7(2)5-15(12(13)17)14-11(16)10-6-18-9(4)8(10)3/h6-7H,5H2,1-4H3,(H2,13,17)(H,14,16) |
| InChIKey | CWQGFPRFPPDZMO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4,5-dimethylthiophene-3-carbonyl)amino]-1-(2-methylpropyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4,5-dimethylthiophene-3-carbonyl)amino]-1-(2-methylpropyl)thiourea?
The IUPAC name of 1-[(4,5-dimethylthiophene-3-carbonyl)amino]-1-(2-methylpropyl)thiourea (CID 22301209) is 1-[(4,5-dimethylthiophene-3-carbonyl)amino]-1-(2-methylpropyl)thiourea.
What is the SMILES notation for 1-[(4,5-dimethylthiophene-3-carbonyl)amino]-1-(2-methylpropyl)thiourea?
The canonical SMILES for 1-[(4,5-dimethylthiophene-3-carbonyl)amino]-1-(2-methylpropyl)thiourea is Cc1scc(C(=O)NN(CC(C)C)C(N)=S)c1C.
What is the InChIKey of 1-[(4,5-dimethylthiophene-3-carbonyl)amino]-1-(2-methylpropyl)thiourea?
The InChIKey is CWQGFPRFPPDZMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3OS2/c1-7(2)5-15(12(13)17)14-11(16)10-6-18-9(4)8(10)3/h6-7H,5H2,1-4H3,(H2,13,17)(H,14,16).
What are the key properties of 1-[(4,5-dimethylthiophene-3-carbonyl)amino]-1-(2-methylpropyl)thiourea?
1-[(4,5-dimethylthiophene-3-carbonyl)amino]-1-(2-methylpropyl)thiourea has a molecular weight of 285.44 g/mol, XLogP of 2.21, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4,5-dimethylthiophene-3-carbonyl)amino]-1-(2-methylpropyl)thiourea is sourced from PubChem (CID 22301209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).