About 1-amino-1-propylthiourea
1-amino-1-propylthiourea (PubChem CID 22301223) has the molecular formula C4H11N3S
and a molecular weight of 133.22 g/mol. Its IUPAC name is 1-amino-1-propylthiourea.
Molecular Properties
| Compound Name | 1-amino-1-propylthiourea |
| PubChem CID | 22301223 |
| Molecular Formula | C4H11N3S |
| Molecular Weight | 133.22 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | 1-amino-1-propylthiourea |
| SMILES | CCCN(N)C(N)=S |
| InChI | InChI=1S/C4H11N3S/c1-2-3-7(6)4(5)8/h2-3,6H2,1H3,(H2,5,8) |
| InChIKey | XUZFXRKTPPDWMN-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.22 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-1-propylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-1-propylthiourea?
The IUPAC name of 1-amino-1-propylthiourea (CID 22301223) is 1-amino-1-propylthiourea.
What is the SMILES notation for 1-amino-1-propylthiourea?
The canonical SMILES for 1-amino-1-propylthiourea is CCCN(N)C(N)=S.
What is the InChIKey of 1-amino-1-propylthiourea?
The InChIKey is XUZFXRKTPPDWMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N3S/c1-2-3-7(6)4(5)8/h2-3,6H2,1H3,(H2,5,8).
What are the key properties of 1-amino-1-propylthiourea?
1-amino-1-propylthiourea has a molecular weight of 133.22 g/mol, XLogP of -0.18, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-1-propylthiourea is sourced from PubChem (CID 22301223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).