About ethyl 1-[[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylamino]piperidin-1-ium-1-carboxylate
ethyl 1-[[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylamino]piperidin-1-ium-1-carboxylate (PubChem CID 22302165) has the molecular formula C15H20N3O5S2+
and a molecular weight of 386.48 g/mol. Its IUPAC name is ethyl 1-[[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylamino]piperidin-1-ium-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylamino]piperidin-1-ium-1-carboxylate |
| PubChem CID | 22302165 |
| Molecular Formula | C15H20N3O5S2+ |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | ethyl 1-[[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylamino]piperidin-1-ium-1-carboxylate |
| SMILES | CCOC(=O)[N+]1(NS(=O)(=O)c2ccc(-c3ccno3)s2)CCCCC1 |
| InChI | InChI=1S/C15H20N3O5S2/c1-2-22-15(19)18(10-4-3-5-11-18)17-25(20,21)14-7-6-13(24-14)12-8-9-16-23-12/h6-9,17H,2-5,10-11H2,1H3/q+1 |
| InChIKey | SJYILHLIQLYQRL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-[[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylamino]piperidin-1-ium-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylamino]piperidin-1-ium-1-carboxylate?
The IUPAC name of ethyl 1-[[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylamino]piperidin-1-ium-1-carboxylate (CID 22302165) is ethyl 1-[[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylamino]piperidin-1-ium-1-carboxylate.
What is the SMILES notation for ethyl 1-[[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylamino]piperidin-1-ium-1-carboxylate?
The canonical SMILES for ethyl 1-[[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylamino]piperidin-1-ium-1-carboxylate is CCOC(=O)[N+]1(NS(=O)(=O)c2ccc(-c3ccno3)s2)CCCCC1.
What is the InChIKey of ethyl 1-[[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylamino]piperidin-1-ium-1-carboxylate?
The InChIKey is SJYILHLIQLYQRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N3O5S2/c1-2-22-15(19)18(10-4-3-5-11-18)17-25(20,21)14-7-6-13(24-14)12-8-9-16-23-12/h6-9,17H,2-5,10-11H2,1H3/q+1.
What are the key properties of ethyl 1-[[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylamino]piperidin-1-ium-1-carboxylate?
ethyl 1-[[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylamino]piperidin-1-ium-1-carboxylate has a molecular weight of 386.48 g/mol, XLogP of 2.75, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylamino]piperidin-1-ium-1-carboxylate is sourced from PubChem (CID 22302165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).