C15H18N6OS2 — CID 22302176
1-[[2-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-1-prop-2-enylthiourea (PubChem CID 22302176) has the molecular formula C15H18N6OS2 and a molecular weight of 362.48 g/mol. Its IUPAC name is 1-[[2-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-1-prop-2-enylthiourea.
| Compound Name | 1-[[2-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-1-prop-2-enylthiourea |
|---|---|
| PubChem CID | 22302176 |
| Molecular Formula | C15H18N6OS2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 1-[[2-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-1-prop-2-enylthiourea |
| SMILES | C=CCN(NC(=O)CSc1nnc(-c2ccccc2)n1C)C(N)=S |
| InChI | InChI=1S/C15H18N6OS2/c1-3-9-21(14(16)23)19-12(22)10-24-15-18-17-13(20(15)2)11-7-5-4-6-8-11/h3-8H,1,9-10H2,2H3,(H2,16,23)(H,19,22) |
| InChIKey | QUOGOBRWGRQTDN-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|