C26H18Cl2N6OS2 — CID 22302180
1-[(5-amino-3,4-diphenylthieno[2,3-c]pyridazine-6-carbonyl)amino]-1-(2,4-dichlorophenyl)thiourea (PubChem CID 22302180) has the molecular formula C26H18Cl2N6OS2 and a molecular weight of 565.51 g/mol. Its IUPAC name is 1-[(5-amino-3,4-diphenylthieno[2,3-c]pyridazine-6-carbonyl)amino]-1-(2,4-dichlorophenyl)thiourea.
| Compound Name | 1-[(5-amino-3,4-diphenylthieno[2,3-c]pyridazine-6-carbonyl)amino]-1-(2,4-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 22302180 |
| Molecular Formula | C26H18Cl2N6OS2 |
| Molecular Weight | 565.51 g/mol |
| Exact Mass | 564.04 |
| IUPAC Name | 1-[(5-amino-3,4-diphenylthieno[2,3-c]pyridazine-6-carbonyl)amino]-1-(2,4-dichlorophenyl)thiourea |
| SMILES | NC(=S)N(NC(=O)c1sc2nnc(-c3ccccc3)c(-c3ccccc3)c2c1N)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H18Cl2N6OS2/c27-16-11-12-18(17(28)13-16)34(26(30)36)33-24(35)23-21(29)20-19(14-7-3-1-4-8-14)22(31-32-25(20)37-23)15-9-5-2-6-10-15/h1-13H,29H2,(H2,30,36)(H,33,35) |
| InChIKey | YFNZTPAUOOVTBT-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.51 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|