C14H17N5OS2 — CID 22302225
1-[(3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carbonyl)amino]-1-prop-2-enylthiourea (PubChem CID 22302225) has the molecular formula C14H17N5OS2 and a molecular weight of 335.46 g/mol. Its IUPAC name is 1-[(3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carbonyl)amino]-1-prop-2-enylthiourea.
| Compound Name | 1-[(3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carbonyl)amino]-1-prop-2-enylthiourea |
|---|---|
| PubChem CID | 22302225 |
| Molecular Formula | C14H17N5OS2 |
| Molecular Weight | 335.46 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 1-[(3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carbonyl)amino]-1-prop-2-enylthiourea |
| SMILES | C=CCN(NC(=O)c1sc2nc(C)cc(C)c2c1N)C(N)=S |
| InChI | InChI=1S/C14H17N5OS2/c1-4-5-19(14(16)21)18-12(20)11-10(15)9-7(2)6-8(3)17-13(9)22-11/h4,6H,1,5,15H2,2-3H3,(H2,16,21)(H,18,20) |
| InChIKey | XISRXIXFMBQSQX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.46 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|