C20H11Cl2F6N3OS — CID 22302593
1-[(E)-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-1-(3,4-dichlorophenyl)thiourea (PubChem CID 22302593) has the molecular formula C20H11Cl2F6N3OS and a molecular weight of 526.29 g/mol. Its IUPAC name is 1-[(E)-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-1-(3,4-dichlorophenyl)thiourea.
| Compound Name | 1-[(E)-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-1-(3,4-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 22302593 |
| Molecular Formula | C20H11Cl2F6N3OS |
| Molecular Weight | 526.29 g/mol |
| Exact Mass | 524.99 |
| IUPAC Name | 1-[(E)-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-1-(3,4-dichlorophenyl)thiourea |
| SMILES | NC(=S)N(/N=C/c1ccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)o1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H11Cl2F6N3OS/c21-15-3-1-13(8-16(15)22)31(18(29)33)30-9-14-2-4-17(32-14)10-5-11(19(23,24)25)7-12(6-10)20(26,27)28/h1-9H,(H2,29,33)/b30-9+ |
| InChIKey | PSPCKYOJUGWGHK-OOEWDAAOSA-N |
| XLogP | 7.38 |
| TPSA | 54.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.29 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|