About [2-imino-2-[2-(1,2-oxazol-5-yl)-1,3-thiazol-4-yl]ethyl] 4-chlorobenzoate
[2-imino-2-[2-(1,2-oxazol-5-yl)-1,3-thiazol-4-yl]ethyl] 4-chlorobenzoate (PubChem CID 22302977) has the molecular formula C15H10ClN3O3S
and a molecular weight of 347.78 g/mol. Its IUPAC name is [2-imino-2-[2-(1,2-oxazol-5-yl)-1,3-thiazol-4-yl]ethyl] 4-chlorobenzoate.
Molecular Properties
| Compound Name | [2-imino-2-[2-(1,2-oxazol-5-yl)-1,3-thiazol-4-yl]ethyl] 4-chlorobenzoate |
| PubChem CID | 22302977 |
| Molecular Formula | C15H10ClN3O3S |
| Molecular Weight | 347.78 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | [2-imino-2-[2-(1,2-oxazol-5-yl)-1,3-thiazol-4-yl]ethyl] 4-chlorobenzoate |
| SMILES | [H]/N=C(/COC(=O)c1ccc(Cl)cc1)c1csc(-c2ccno2)n1 |
| InChI | InChI=1S/C15H10ClN3O3S/c16-10-3-1-9(2-4-10)15(20)21-7-11(17)12-8-23-14(19-12)13-5-6-18-22-13/h1-6,8,17H,7H2/b17-11- |
| InChIKey | YKVAEOCLLDYEST-BOPFTXTBSA-N |
| XLogP | 3.68 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.78 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [2-imino-2-[2-(1,2-oxazol-5-yl)-1,3-thiazol-4-yl]ethyl] 4-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-imino-2-[2-(1,2-oxazol-5-yl)-1,3-thiazol-4-yl]ethyl] 4-chlorobenzoate?
The IUPAC name of [2-imino-2-[2-(1,2-oxazol-5-yl)-1,3-thiazol-4-yl]ethyl] 4-chlorobenzoate (CID 22302977) is [2-imino-2-[2-(1,2-oxazol-5-yl)-1,3-thiazol-4-yl]ethyl] 4-chlorobenzoate.
What is the SMILES notation for [2-imino-2-[2-(1,2-oxazol-5-yl)-1,3-thiazol-4-yl]ethyl] 4-chlorobenzoate?
The canonical SMILES for [2-imino-2-[2-(1,2-oxazol-5-yl)-1,3-thiazol-4-yl]ethyl] 4-chlorobenzoate is [H]/N=C(/COC(=O)c1ccc(Cl)cc1)c1csc(-c2ccno2)n1.
What is the InChIKey of [2-imino-2-[2-(1,2-oxazol-5-yl)-1,3-thiazol-4-yl]ethyl] 4-chlorobenzoate?
The InChIKey is YKVAEOCLLDYEST-BOPFTXTBSA-N. The full InChI is InChI=1S/C15H10ClN3O3S/c16-10-3-1-9(2-4-10)15(20)21-7-11(17)12-8-23-14(19-12)13-5-6-18-22-13/h1-6,8,17H,7H2/b17-11-.
What are the key properties of [2-imino-2-[2-(1,2-oxazol-5-yl)-1,3-thiazol-4-yl]ethyl] 4-chlorobenzoate?
[2-imino-2-[2-(1,2-oxazol-5-yl)-1,3-thiazol-4-yl]ethyl] 4-chlorobenzoate has a molecular weight of 347.78 g/mol, XLogP of 3.68, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-imino-2-[2-(1,2-oxazol-5-yl)-1,3-thiazol-4-yl]ethyl] 4-chlorobenzoate is sourced from PubChem (CID 22302977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).