C26H45NO7S — CID 22303101
2-[[(4R)-4-[(8S,9R,10S,13R,14R,17R)-3,8,12-trihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonic acid (PubChem CID 22303101) has the molecular formula C26H45NO7S and a molecular weight of 515.71 g/mol. Its IUPAC name is 2-[[(4R)-4-[(8S,9R,10S,13R,14R,17R)-3,8,12-trihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[(4R)-4-[(8S,9R,10S,13R,14R,17R)-3,8,12-trihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 22303101 |
| Molecular Formula | C26H45NO7S |
| Molecular Weight | 515.71 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | 2-[[(4R)-4-[(8S,9R,10S,13R,14R,17R)-3,8,12-trihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonic acid |
| SMILES | C[C@H](CCC(=O)NCCS(=O)(=O)O)[C@H]1CC[C@H]2[C@]3(O)CCC4CC(O)CC[C@]4(C)[C@H]3CC(O)[C@]12C |
| InChI | InChI=1S/C26H45NO7S/c1-16(4-7-23(30)27-12-13-35(32,33)34)19-5-6-20-25(19,3)22(29)15-21-24(2)10-9-18(28)14-17(24)8-11-26(20,21)31/h16-22,28-29,31H,4-15H2,1-3H3,(H,27,30)(H,32,33,34)/t16-,17?,18?,19-,20-,21-,22?,24+,25-,26-/m1/s1 |
| InChIKey | QZTRRTOMKSKXLP-JSZVBTCCSA-N |
| XLogP | 2.51 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.71 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|