C13H7F7N4S — CID 22303590
1-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]-1-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 22303590) has the molecular formula C13H7F7N4S and a molecular weight of 384.28 g/mol. Its IUPAC name is 1-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]-1-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]-1-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 22303590 |
| Molecular Formula | C13H7F7N4S |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | 1-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]-1-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | NC(=S)N(Nc1c(F)c(F)nc(F)c1F)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H7F7N4S/c14-7-9(8(15)11(17)22-10(7)16)23-24(12(21)25)6-3-1-2-5(4-6)13(18,19)20/h1-4H,(H2,21,25)(H,22,23) |
| InChIKey | ZNKPMWOAVSNHPX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|