C21H21NO6S — CID 2230478
(5Z)-5-[[3-methoxy-4-[3-(2-methoxyphenoxy)propoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 2230478) has the molecular formula C21H21NO6S and a molecular weight of 415.47 g/mol. Its IUPAC name is (5Z)-5-[[3-methoxy-4-[3-(2-methoxyphenoxy)propoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-methoxy-4-[3-(2-methoxyphenoxy)propoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 2230478 |
| Molecular Formula | C21H21NO6S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | (5Z)-5-[[3-methoxy-4-[3-(2-methoxyphenoxy)propoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccccc1OCCCOc1ccc(/C=C2\SC(=O)NC2=O)cc1OC |
| InChI | InChI=1S/C21H21NO6S/c1-25-15-6-3-4-7-16(15)27-10-5-11-28-17-9-8-14(12-18(17)26-2)13-19-20(23)22-21(24)29-19/h3-4,6-9,12-13H,5,10-11H2,1-2H3,(H,22,23,24)/b19-13- |
| InChIKey | QPEFLXIIGMEIOY-UYRXBGFRSA-N |
| XLogP | 3.88 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|